C17H17BrN2 — CID 3920528
2-(4-bromophenyl)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile (PubChem CID 3920528) has the molecular formula C17H17BrN2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile.
| Compound Name | 2-(4-bromophenyl)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3920528 |
| Molecular Formula | C17H17BrN2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(4-bromophenyl)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile |
| SMILES | CCn1c(C)cc(C=C(C#N)c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C17H17BrN2/c1-4-20-12(2)9-15(13(20)3)10-16(11-19)14-5-7-17(18)8-6-14/h5-10H,4H2,1-3H3 |
| InChIKey | UJGPWXFBERDMNR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|