C24H17N3O8 — CID 39113784
[4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 39113784) has the molecular formula C24H17N3O8 and a molecular weight of 475.41 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 39113784 |
| Molecular Formula | C24H17N3O8 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | COc1ccc(/C(C#N)=C\c2ccc(OC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)cc1OC |
| InChI | InChI=1S/C24H17N3O8/c1-33-22-8-5-16(12-23(22)34-2)18(14-25)9-15-3-6-21(7-4-15)35-24(28)17-10-19(26(29)30)13-20(11-17)27(31)32/h3-13H,1-2H3/b18-9- |
| InChIKey | IJYBBXHREYFXBH-NVMNQCDNSA-N |
| XLogP | 4.80 |
| TPSA | 154.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|