C17H16NO6P — CID 69272257
[4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate (PubChem CID 69272257) has the molecular formula C17H16NO6P and a molecular weight of 361.29 g/mol. Its IUPAC name is [4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69272257 |
| Molecular Formula | C17H16NO6P |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(C(C#N)=Cc2ccc(OP(=O)(O)O)cc2)cc1OC |
| InChI | InChI=1S/C17H16NO6P/c1-22-16-8-5-13(10-17(16)23-2)14(11-18)9-12-3-6-15(7-4-12)24-25(19,20)21/h3-10H,1-2H3,(H2,19,20,21) |
| InChIKey | BECIDEZZGCESKP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|