C23H25NNaO11P — CID 23673842
sodium [3-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]-4,5,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate (PubChem CID 23673842) has the molecular formula C23H25NNaO11P and a molecular weight of 545.41 g/mol. Its IUPAC name is sodium [3-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]-4,5,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate.
| Compound Name | sodium [3-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]-4,5,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 23673842 |
| Molecular Formula | C23H25NNaO11P |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | sodium [3-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]-4,5,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(OC3C(COP(=O)([O-])O)OC(O)C(O)C3O)cc2)cc1OC.[Na+] |
| InChI | InChI=1S/C23H26NO11P.Na/c1-31-17-8-5-14(10-18(17)32-2)15(11-24)9-13-3-6-16(7-4-13)34-22-19(12-33-36(28,29)30)35-23(27)21(26)20(22)25;/h3-10,19-23,25-27H,12H2,1-2H3,(H2,28,29,30);/q;+1/p-1/b15-9+; |
| InChIKey | LKKNEBMMDVZGNT-NSPIFIKESA-M |
| XLogP | -2.56 |
| TPSA | 190.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|