C23H27NNaO10P — CID 173153702
sodium;[(2R,3S,4R,5R,6S)-6-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate;hydride (PubChem CID 173153702) has the molecular formula C23H27NNaO10P and a molecular weight of 531.43 g/mol. Its IUPAC name is sodium;[(2R,3S,4R,5R,6S)-6-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate;hydride.
| Compound Name | sodium;[(2R,3S,4R,5R,6S)-6-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 173153702 |
| Molecular Formula | C23H27NNaO10P |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | sodium;[(2R,3S,4R,5R,6S)-6-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate;hydride |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]3O)cc2)cc1OC.[H-].[Na+] |
| InChI | InChI=1S/C23H26NO10P.Na.H/c1-31-17-8-7-15(10-18(17)32-2)16(11-24)9-13-3-5-14(6-4-13)23-22(27)21(26)20(25)19(34-23)12-33-35(28,29)30;;/h3-10,19-23,25-27H,12H2,1-2H3,(H2,28,29,30);;/q;+1;-1/b16-9+;;/t19-,20-,21+,22-,23+;;/m1../s1 |
| InChIKey | IIWKIIBDEZKVEG-DCIUTKJMSA-N |
| XLogP | -1.48 |
| TPSA | 178.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|