C17H15NNaO3+ — CID 23089833
sodium (Z)-2-(3,4-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 23089833) has the molecular formula C17H15NNaO3+ and a molecular weight of 304.30 g/mol. Its IUPAC name is sodium (Z)-2-(3,4-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | sodium (Z)-2-(3,4-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 23089833 |
| Molecular Formula | C17H15NNaO3+ |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | sodium (Z)-2-(3,4-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(O)cc2)cc1OC.[Na+] |
| InChI | InChI=1S/C17H15NO3.Na/c1-20-16-8-5-13(10-17(16)21-2)14(11-18)9-12-3-6-15(19)7-4-12;/h3-10,19H,1-2H3;/q;+1/b14-9+; |
| InChIKey | HCKIQCYITNCKAA-KYIGKLDSSA-N |
| XLogP | 0.48 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|