C28H29NO4 — CID 39113804
[4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] adamantane-1-carboxylate (PubChem CID 39113804) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] adamantane-1-carboxylate.
| Compound Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 39113804 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] adamantane-1-carboxylate |
| SMILES | COc1ccc(/C(C#N)=C\c2ccc(OC(=O)C34CC5CC(CC(C5)C3)C4)cc2)cc1OC |
| InChI | InChI=1S/C28H29NO4/c1-31-25-8-5-22(13-26(25)32-2)23(17-29)12-18-3-6-24(7-4-18)33-27(30)28-14-19-9-20(15-28)11-21(10-19)16-28/h3-8,12-13,19-21H,9-11,14-16H2,1-2H3/b23-12- |
| InChIKey | KCSRKNUZGZMZQC-FMCGGJTJSA-N |
| XLogP | 5.89 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|