C21H28N6O3 — CID 133336279
4-[[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]amino]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133336279) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]amino]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]amino]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133336279 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-[[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]amino]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | Cc1cc(N2CCC(Nc3ccc(C(=O)NC(C)C)cc3[N+](=O)[O-])CC2)nc(C)n1 |
| InChI | InChI=1S/C21H28N6O3/c1-13(2)22-21(28)16-5-6-18(19(12-16)27(29)30)25-17-7-9-26(10-8-17)20-11-14(3)23-15(4)24-20/h5-6,11-13,17,25H,7-10H2,1-4H3,(H,22,28) |
| InChIKey | LMISMWCIHXOQEJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|