C22H33N5O5 — CID 141387339
tert-butyl (3R)-3-[[1-[(2S)-2-methoxypropyl]-5-nitroindazol-6-yl]amino]azepane-1-carboxylate (PubChem CID 141387339) has the molecular formula C22H33N5O5 and a molecular weight of 447.54 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[1-[(2S)-2-methoxypropyl]-5-nitroindazol-6-yl]amino]azepane-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[1-[(2S)-2-methoxypropyl]-5-nitroindazol-6-yl]amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 141387339 |
| Molecular Formula | C22H33N5O5 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | tert-butyl (3R)-3-[[1-[(2S)-2-methoxypropyl]-5-nitroindazol-6-yl]amino]azepane-1-carboxylate |
| SMILES | CO[C@@H](C)Cn1ncc2cc([N+](=O)[O-])c(N[C@@H]3CCCCN(C(=O)OC(C)(C)C)C3)cc21 |
| InChI | InChI=1S/C22H33N5O5/c1-15(31-5)13-26-19-11-18(20(27(29)30)10-16(19)12-23-26)24-17-8-6-7-9-25(14-17)21(28)32-22(2,3)4/h10-12,15,17,24H,6-9,13-14H2,1-5H3/t15-,17+/m0/s1 |
| InChIKey | URIPOANHZILWFZ-DOTOQJQBSA-N |
| XLogP | 4.18 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|