C16H22N6O4S — CID 58972288
tert-butyl (3S)-3-[(7-methylsulfanyl-3-nitropyrazolo[1,5-a]pyrimidin-5-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 58972288) has the molecular formula C16H22N6O4S and a molecular weight of 394.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(7-methylsulfanyl-3-nitropyrazolo[1,5-a]pyrimidin-5-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(7-methylsulfanyl-3-nitropyrazolo[1,5-a]pyrimidin-5-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58972288 |
| Molecular Formula | C16H22N6O4S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | tert-butyl (3S)-3-[(7-methylsulfanyl-3-nitropyrazolo[1,5-a]pyrimidin-5-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CSc1cc(N[C@H]2CCN(C(=O)OC(C)(C)C)C2)nc2c([N+](=O)[O-])cnn12 |
| InChI | InChI=1S/C16H22N6O4S/c1-16(2,3)26-15(23)20-6-5-10(9-20)18-12-7-13(27-4)21-14(19-12)11(8-17-21)22(24)25/h7-8,10H,5-6,9H2,1-4H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | XPSWVSPMRPQGSZ-JTQLQIEISA-N |
| XLogP | 2.78 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|