C26H34N6O5 — CID 155272997
tert-butyl (3S)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-propan-2-ylanilino]piperidine-1-carboxylate (PubChem CID 155272997) has the molecular formula C26H34N6O5 and a molecular weight of 510.60 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-propan-2-ylanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-propan-2-ylanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155272997 |
| Molecular Formula | C26H34N6O5 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | tert-butyl (3S)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-propan-2-ylanilino]piperidine-1-carboxylate |
| SMILES | COc1cc(-c2cc([N+](=O)[O-])c(N[C@H]3CCCN(C(=O)OC(C)(C)C)C3)cc2C(C)C)cn2ncnc12 |
| InChI | InChI=1S/C26H34N6O5/c1-16(2)19-11-21(29-18-8-7-9-30(14-18)25(33)37-26(3,4)5)22(32(34)35)12-20(19)17-10-23(36-6)24-27-15-28-31(24)13-17/h10-13,15-16,18,29H,7-9,14H2,1-6H3/t18-/m0/s1 |
| InChIKey | SJUNOZSIYZCVSR-SFHVURJKSA-N |
| XLogP | 5.25 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|