C25H31N5O5 — CID 167691275
tert-butyl 4-[[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-methyl-2-nitrophenyl]methyl]piperidine-1-carboxylate (PubChem CID 167691275) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is tert-butyl 4-[[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-methyl-2-nitrophenyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-methyl-2-nitrophenyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167691275 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | tert-butyl 4-[[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-5-methyl-2-nitrophenyl]methyl]piperidine-1-carboxylate |
| SMILES | COc1cc(-c2cc([N+](=O)[O-])c(CC3CCN(C(=O)OC(C)(C)C)CC3)cc2C)cn2ncnc12 |
| InChI | InChI=1S/C25H31N5O5/c1-16-10-18(11-17-6-8-28(9-7-17)24(31)35-25(2,3)4)21(30(32)33)13-20(16)19-12-22(34-5)23-26-15-27-29(23)14-19/h10,12-15,17H,6-9,11H2,1-5H3 |
| InChIKey | WZGYITOSTBFNET-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|