C25H31N5O4 — CID 167550600
tert-butyl 4-[[2-methyl-4-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-nitrophenyl]methyl]piperidine-1-carboxylate (PubChem CID 167550600) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is tert-butyl 4-[[2-methyl-4-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-nitrophenyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-methyl-4-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-nitrophenyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167550600 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | tert-butyl 4-[[2-methyl-4-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-nitrophenyl]methyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(-c2cc(C)c3ncnn3c2)cc([N+](=O)[O-])c1CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H31N5O4/c1-16-10-19(20-11-17(2)23-26-15-27-29(23)14-20)13-22(30(32)33)21(16)12-18-6-8-28(9-7-18)24(31)34-25(3,4)5/h10-11,13-15,18H,6-9,12H2,1-5H3 |
| InChIKey | CIVOQNXCSLPVAO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|