C21H34N2O5Si — CID 23659015
tert-butyl 4-[2-methyl-4-nitro-5-(trimethylsilylmethyl)phenoxy]piperidine-1-carboxylate (PubChem CID 23659015) has the molecular formula C21H34N2O5Si and a molecular weight of 422.60 g/mol. Its IUPAC name is tert-butyl 4-[2-methyl-4-nitro-5-(trimethylsilylmethyl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-methyl-4-nitro-5-(trimethylsilylmethyl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23659015 |
| Molecular Formula | C21H34N2O5Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | tert-butyl 4-[2-methyl-4-nitro-5-(trimethylsilylmethyl)phenoxy]piperidine-1-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])c(C[Si](C)(C)C)cc1OC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H34N2O5Si/c1-15-12-18(23(25)26)16(14-29(5,6)7)13-19(15)27-17-8-10-22(11-9-17)20(24)28-21(2,3)4/h12-13,17H,8-11,14H2,1-7H3 |
| InChIKey | JJSOSAULLVQRND-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|