C18H25N3O4 — CID 22100795
tert-butyl 4-[(6-hydroxy-2-methyl-1H-benzimidazol-5-yl)oxy]piperidine-1-carboxylate (PubChem CID 22100795) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl 4-[(6-hydroxy-2-methyl-1H-benzimidazol-5-yl)oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-hydroxy-2-methyl-1H-benzimidazol-5-yl)oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22100795 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl 4-[(6-hydroxy-2-methyl-1H-benzimidazol-5-yl)oxy]piperidine-1-carboxylate |
| SMILES | Cc1nc2cc(OC3CCN(C(=O)OC(C)(C)C)CC3)c(O)cc2[nH]1 |
| InChI | InChI=1S/C18H25N3O4/c1-11-19-13-9-15(22)16(10-14(13)20-11)24-12-5-7-21(8-6-12)17(23)25-18(2,3)4/h9-10,12,22H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | YBHLQPAFEWZDAH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |