C17H24N4O2 — CID 103818698
tert-butyl 3-[(2-methyl-3H-benzimidazol-5-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 103818698) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is tert-butyl 3-[(2-methyl-3H-benzimidazol-5-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methyl-3H-benzimidazol-5-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103818698 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl 3-[(2-methyl-3H-benzimidazol-5-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | Cc1nc2ccc(NC3CCN(C(=O)OC(C)(C)C)C3)cc2[nH]1 |
| InChI | InChI=1S/C17H24N4O2/c1-11-18-14-6-5-12(9-15(14)19-11)20-13-7-8-21(10-13)16(22)23-17(2,3)4/h5-6,9,13,20H,7-8,10H2,1-4H3,(H,18,19) |
| InChIKey | PLJVONRVZNNYAX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |