C18H27N3O5S — CID 174321283
tert-butyl 4-[2-[(4-nitrophenyl)sulfanylamino]ethoxy]piperidine-1-carboxylate (PubChem CID 174321283) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-nitrophenyl)sulfanylamino]ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-nitrophenyl)sulfanylamino]ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174321283 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | tert-butyl 4-[2-[(4-nitrophenyl)sulfanylamino]ethoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCCNSc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H27N3O5S/c1-18(2,3)26-17(22)20-11-8-15(9-12-20)25-13-10-19-27-16-6-4-14(5-7-16)21(23)24/h4-7,15,19H,8-13H2,1-3H3 |
| InChIKey | VQJPJKOTQHNMDW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|