C18H27N2NaO3 — CID 23682953
sodium;tert-butyl 3-oxo-4-(3-phenylpropyl)piperazine-1-carboxylate;hydride (PubChem CID 23682953) has the molecular formula C18H27N2NaO3 and a molecular weight of 342.41 g/mol. Its IUPAC name is sodium;tert-butyl 3-oxo-4-(3-phenylpropyl)piperazine-1-carboxylate;hydride.
| Compound Name | sodium;tert-butyl 3-oxo-4-(3-phenylpropyl)piperazine-1-carboxylate;hydride |
|---|---|
| PubChem CID | 23682953 |
| Molecular Formula | C18H27N2NaO3 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | sodium;tert-butyl 3-oxo-4-(3-phenylpropyl)piperazine-1-carboxylate;hydride |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCc2ccccc2)C(=O)C1.[H-].[Na+] |
| InChI | InChI=1S/C18H26N2O3.Na.H/c1-18(2,3)23-17(22)20-13-12-19(16(21)14-20)11-7-10-15-8-5-4-6-9-15;;/h4-6,8-9H,7,10-14H2,1-3H3;;/q;+1;-1 |
| InChIKey | HLDUAMOQFBBWAU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |