C10H13N5O2 — CID 66062201
4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazine-2,6-dione (PubChem CID 66062201) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazine-2,6-dione.
| Compound Name | 4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66062201 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazine-2,6-dione |
| SMILES | NNc1ncccc1CN1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C10H13N5O2/c11-14-10-7(2-1-3-12-10)4-15-5-8(16)13-9(17)6-15/h1-3H,4-6,11H2,(H,12,14)(H,13,16,17) |
| InChIKey | GXQXJYWRLBEYCJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|