C12H18F3N5 — CID 62968441
[3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine (PubChem CID 62968441) has the molecular formula C12H18F3N5 and a molecular weight of 289.30 g/mol. Its IUPAC name is [3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine.
| Compound Name | [3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62968441 |
| Molecular Formula | C12H18F3N5 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | [3-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ncccc1CN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F3N5/c13-12(14,15)9-20-6-4-19(5-7-20)8-10-2-1-3-17-11(10)18-16/h1-3H,4-9,16H2,(H,17,18) |
| InChIKey | GUSRWOPDBYLAIF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|