C19H20N4O2 — CID 23606550
7-methyl-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]chromen-2-one (PubChem CID 23606550) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 7-methyl-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]chromen-2-one.
| Compound Name | 7-methyl-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 23606550 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 7-methyl-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]chromen-2-one |
| SMILES | Cc1ccc2c(CN3CCN(c4ncccn4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H20N4O2/c1-14-3-4-16-15(12-18(24)25-17(16)11-14)13-22-7-9-23(10-8-22)19-20-5-2-6-21-19/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | RTBLHXOYRZLIDZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|