C24H25N3O3S — CID 17250966
7-methyl-4-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazin-1-yl]methyl]chromen-2-one (PubChem CID 17250966) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 7-methyl-4-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 7-methyl-4-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 17250966 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 7-methyl-4-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1ccc2c(CN3CCN(Cc4nc(-c5cccs5)oc4C)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H25N3O3S/c1-16-5-6-19-18(13-23(28)30-21(19)12-16)14-26-7-9-27(10-8-26)15-20-17(2)29-24(25-20)22-4-3-11-31-22/h3-6,11-13H,7-10,14-15H2,1-2H3 |
| InChIKey | VZUVLKZVOBWZKW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|