C25H22N2O5 — CID 23608188
7-methyl-4-[[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]methyl]chromen-2-one (PubChem CID 23608188) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 7-methyl-4-[[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 7-methyl-4-[[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 23608188 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 7-methyl-4-[[4-(2-oxochromene-3-carbonyl)piperazin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1ccc2c(CN3CCN(C(=O)c4cc5ccccc5oc4=O)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H22N2O5/c1-16-6-7-19-18(14-23(28)31-22(19)12-16)15-26-8-10-27(11-9-26)24(29)20-13-17-4-2-3-5-21(17)32-25(20)30/h2-7,12-14H,8-11,15H2,1H3 |
| InChIKey | LFBSCWAXUJZEHI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|