C24H29N3O4 — CID 172896482
6,7-dimethyl-4-[[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]methyl]chromen-2-one;formic acid (PubChem CID 172896482) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]methyl]chromen-2-one;formic acid.
| Compound Name | 6,7-dimethyl-4-[[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]methyl]chromen-2-one;formic acid |
|---|---|
| PubChem CID | 172896482 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 6,7-dimethyl-4-[[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]methyl]chromen-2-one;formic acid |
| SMILES | Cc1cc2oc(=O)cc(CN3CCCN(Cc4ccccn4)CC3)c2cc1C.O=CO |
| InChI | InChI=1S/C23H27N3O2.CH2O2/c1-17-12-21-19(14-23(27)28-22(21)13-18(17)2)15-25-8-5-9-26(11-10-25)16-20-6-3-4-7-24-20;2-1-3/h3-4,6-7,12-14H,5,8-11,15-16H2,1-2H3;1H,(H,2,3) |
| InChIKey | VUSXCACZWHLFPR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|