C15H21F2N3O3S — CID 39998547
4-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]sulfonylmorpholine (PubChem CID 39998547) has the molecular formula C15H21F2N3O3S and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]sulfonylmorpholine.
| Compound Name | 4-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 39998547 |
| Molecular Formula | C15H21F2N3O3S |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]sulfonylmorpholine |
| SMILES | O=S(=O)(N1CCOCC1)N1CCN(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C15H21F2N3O3S/c16-14-3-1-2-13(15(14)17)12-18-4-6-19(7-5-18)24(21,22)20-8-10-23-11-9-20/h1-3H,4-12H2 |
| InChIKey | DRTBXPLOBHTAAL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |