C14H21FN4O2S — CID 141137870
3-[[4-(azetidin-1-ylsulfonyl)piperazin-1-yl]methyl]-2-fluoroaniline (PubChem CID 141137870) has the molecular formula C14H21FN4O2S and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[[4-(azetidin-1-ylsulfonyl)piperazin-1-yl]methyl]-2-fluoroaniline.
| Compound Name | 3-[[4-(azetidin-1-ylsulfonyl)piperazin-1-yl]methyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 141137870 |
| Molecular Formula | C14H21FN4O2S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-[[4-(azetidin-1-ylsulfonyl)piperazin-1-yl]methyl]-2-fluoroaniline |
| SMILES | Nc1cccc(CN2CCN(S(=O)(=O)N3CCC3)CC2)c1F |
| InChI | InChI=1S/C14H21FN4O2S/c15-14-12(3-1-4-13(14)16)11-17-7-9-19(10-8-17)22(20,21)18-5-2-6-18/h1,3-4H,2,5-11,16H2 |
| InChIKey | QTFBBZFBMCINAS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|