C15H21F2N3O2S — CID 47023387
1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylpiperazine (PubChem CID 47023387) has the molecular formula C15H21F2N3O2S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylpiperazine.
| Compound Name | 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 47023387 |
| Molecular Formula | C15H21F2N3O2S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylpiperazine |
| SMILES | O=S(=O)(N1CCCC1)N1CCN(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C15H21F2N3O2S/c16-14-5-3-4-13(15(14)17)12-18-8-10-20(11-9-18)23(21,22)19-6-1-2-7-19/h3-5H,1-2,6-12H2 |
| InChIKey | KEAPSUNHFJMKQO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |