C17H17F2NO4S — CID 39413041
4-[4-[(2,3-difluorophenyl)methoxy]phenyl]sulfonylmorpholine (PubChem CID 39413041) has the molecular formula C17H17F2NO4S and a molecular weight of 369.39 g/mol. Its IUPAC name is 4-[4-[(2,3-difluorophenyl)methoxy]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[(2,3-difluorophenyl)methoxy]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 39413041 |
| Molecular Formula | C17H17F2NO4S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-[4-[(2,3-difluorophenyl)methoxy]phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(OCc2cccc(F)c2F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H17F2NO4S/c18-16-3-1-2-13(17(16)19)12-24-14-4-6-15(7-5-14)25(21,22)20-8-10-23-11-9-20/h1-7H,8-12H2 |
| InChIKey | YAOMHMGZKQIFHZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |