C15H18N2O5S — CID 39413047
4-[4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]sulfonylmorpholine (PubChem CID 39413047) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 4-[4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 39413047 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]sulfonylmorpholine |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)N3CCOCC3)cc2)on1 |
| InChI | InChI=1S/C15H18N2O5S/c1-12-10-14(22-16-12)11-21-13-2-4-15(5-3-13)23(18,19)17-6-8-20-9-7-17/h2-5,10H,6-9,11H2,1H3 |
| InChIKey | NMRRHXJGGVDSKC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |