C18H21NO7S — CID 9331544
methyl 2-methyl-5-[(4-morpholin-4-ylsulfonylphenoxy)methyl]furan-3-carboxylate (PubChem CID 9331544) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is methyl 2-methyl-5-[(4-morpholin-4-ylsulfonylphenoxy)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(4-morpholin-4-ylsulfonylphenoxy)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 9331544 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | methyl 2-methyl-5-[(4-morpholin-4-ylsulfonylphenoxy)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(COc2ccc(S(=O)(=O)N3CCOCC3)cc2)oc1C |
| InChI | InChI=1S/C18H21NO7S/c1-13-17(18(20)23-2)11-15(26-13)12-25-14-3-5-16(6-4-14)27(21,22)19-7-9-24-10-8-19/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | YCLJKYWUHLJTEL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |