C12H16ClN3O2S2 — CID 60676123
2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile (PubChem CID 60676123) has the molecular formula C12H16ClN3O2S2 and a molecular weight of 333.87 g/mol. Its IUPAC name is 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile.
| Compound Name | 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 60676123 |
| Molecular Formula | C12H16ClN3O2S2 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H16ClN3O2S2/c1-12(2,9-14)15-5-7-16(8-6-15)20(17,18)11-4-3-10(13)19-11/h3-4H,5-8H2,1-2H3 |
| InChIKey | NGZCBUCOGMSCIS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |