C13H13ClFNO2S2 — CID 134002504
2-chloro-4-fluoro-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 134002504) has the molecular formula C13H13ClFNO2S2 and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2-chloro-4-fluoro-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134002504 |
| Molecular Formula | C13H13ClFNO2S2 |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-chloro-4-fluoro-N-methyl-N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccsc1CN(C)S(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H13ClFNO2S2/c1-9-5-6-19-12(9)8-16(2)20(17,18)13-4-3-10(15)7-11(13)14/h3-7H,8H2,1-2H3 |
| InChIKey | NOYQYQFTDXWCFR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |