C15H26ClN3O4S — CID 119992357
N-(3-amino-4-methylpentyl)-N,2,3-trimethyl-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119992357) has the molecular formula C15H26ClN3O4S and a molecular weight of 379.91 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N,2,3-trimethyl-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N,2,3-trimethyl-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119992357 |
| Molecular Formula | C15H26ClN3O4S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N,2,3-trimethyl-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N(C)CCC(N)C(C)C)c1C.Cl |
| InChI | InChI=1S/C15H25N3O4S.ClH/c1-10(2)14(16)6-7-17(5)23(21,22)15-9-13(18(19)20)8-11(3)12(15)4;/h8-10,14H,6-7,16H2,1-5H3;1H |
| InChIKey | XHNSWCXMFBUHGJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|