C11H15ClN2O4S — CID 54997716
methyl 3-[(5-amino-2-chlorophenyl)sulfonyl-methylamino]propanoate (PubChem CID 54997716) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is methyl 3-[(5-amino-2-chlorophenyl)sulfonyl-methylamino]propanoate.
| Compound Name | methyl 3-[(5-amino-2-chlorophenyl)sulfonyl-methylamino]propanoate |
|---|---|
| PubChem CID | 54997716 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | methyl 3-[(5-amino-2-chlorophenyl)sulfonyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)c1cc(N)ccc1Cl |
| InChI | InChI=1S/C11H15ClN2O4S/c1-14(6-5-11(15)18-2)19(16,17)10-7-8(13)3-4-9(10)12/h3-4,7H,5-6,13H2,1-2H3 |
| InChIKey | UAFUIJREFFVWFM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|