C10H12Cl3NO4S — CID 50876379
2,3,4-trichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 50876379) has the molecular formula C10H12Cl3NO4S and a molecular weight of 348.64 g/mol. Its IUPAC name is 2,3,4-trichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 2,3,4-trichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50876379 |
| Molecular Formula | C10H12Cl3NO4S |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 2,3,4-trichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1Cl)N(CCO)CCO |
| InChI | InChI=1S/C10H12Cl3NO4S/c11-7-1-2-8(10(13)9(7)12)19(17,18)14(3-5-15)4-6-16/h1-2,15-16H,3-6H2 |
| InChIKey | RQWLLZCUCGGLDK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|