C10H12BrCl2NO4S — CID 61217623
4-bromo-2,6-dichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 61217623) has the molecular formula C10H12BrCl2NO4S and a molecular weight of 393.09 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61217623 |
| Molecular Formula | C10H12BrCl2NO4S |
| Molecular Weight | 393.09 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | 4-bromo-2,6-dichloro-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N(CCO)CCO |
| InChI | InChI=1S/C10H12BrCl2NO4S/c11-7-5-8(12)10(9(13)6-7)19(17,18)14(1-3-15)2-4-16/h5-6,15-16H,1-4H2 |
| InChIKey | LJUJUHSMFCCYFP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.09 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |