C16H15BrCl2N2O3S — CID 24555937
3-[benzyl-(4-bromo-2,6-dichlorophenyl)sulfonylamino]propanamide (PubChem CID 24555937) has the molecular formula C16H15BrCl2N2O3S and a molecular weight of 466.18 g/mol. Its IUPAC name is 3-[benzyl-(4-bromo-2,6-dichlorophenyl)sulfonylamino]propanamide.
| Compound Name | 3-[benzyl-(4-bromo-2,6-dichlorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 24555937 |
| Molecular Formula | C16H15BrCl2N2O3S |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | 3-[benzyl-(4-bromo-2,6-dichlorophenyl)sulfonylamino]propanamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C16H15BrCl2N2O3S/c17-12-8-13(18)16(14(19)9-12)25(23,24)21(7-6-15(20)22)10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H2,20,22) |
| InChIKey | LZLQWGNBWMCBOR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |