C16H18F2N2O2S — CID 120664086
N-(3-aminopropyl)-N-benzyl-2,6-difluorobenzenesulfonamide (PubChem CID 120664086) has the molecular formula C16H18F2N2O2S and a molecular weight of 340.39 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-2,6-difluorobenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-N-benzyl-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 120664086 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-2,6-difluorobenzenesulfonamide |
| SMILES | NCCCN(Cc1ccccc1)S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H18F2N2O2S/c17-14-8-4-9-15(18)16(14)23(21,22)20(11-5-10-19)12-13-6-2-1-3-7-13/h1-4,6-9H,5,10-12,19H2 |
| InChIKey | YSZIRZDOIAIGEA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |