C18H21FN2O4S — CID 120664186
methyl 2-[3-aminopropyl(benzyl)sulfamoyl]-6-fluorobenzoate (PubChem CID 120664186) has the molecular formula C18H21FN2O4S and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 2-[3-aminopropyl(benzyl)sulfamoyl]-6-fluorobenzoate.
| Compound Name | methyl 2-[3-aminopropyl(benzyl)sulfamoyl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 120664186 |
| Molecular Formula | C18H21FN2O4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | methyl 2-[3-aminopropyl(benzyl)sulfamoyl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1S(=O)(=O)N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C18H21FN2O4S/c1-25-18(22)17-15(19)9-5-10-16(17)26(23,24)21(12-6-11-20)13-14-7-3-2-4-8-14/h2-5,7-10H,6,11-13,20H2,1H3 |
| InChIKey | VUCCOLAJFRDLOS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |