About methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate
methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate (PubChem CID 119991903) has the molecular formula C14H21FN2O4S
and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate |
| PubChem CID | 119991903 |
| Molecular Formula | C14H21FN2O4S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1S(=O)(=O)N(C)CC(C)(C)CN |
| InChI | InChI=1S/C14H21FN2O4S/c1-14(2,8-16)9-17(3)22(19,20)11-7-5-6-10(15)12(11)13(18)21-4/h5-7H,8-9,16H2,1-4H3 |
| InChIKey | ZBXLBIGHQVILMG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate?
The IUPAC name of methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate (CID 119991903) is methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate.
What is the SMILES notation for methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate?
The canonical SMILES for methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate is COC(=O)c1c(F)cccc1S(=O)(=O)N(C)CC(C)(C)CN.
What is the InChIKey of methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate?
The InChIKey is ZBXLBIGHQVILMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FN2O4S/c1-14(2,8-16)9-17(3)22(19,20)11-7-5-6-10(15)12(11)13(18)21-4/h5-7H,8-9,16H2,1-4H3.
What are the key properties of methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate?
methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate has a molecular weight of 332.40 g/mol, XLogP of 1.22, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-6-fluorobenzoate is sourced from PubChem (CID 119991903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).