C10H6BrCl2N3O2S — CID 51889727
4-bromo-2,6-dichloro-N,N-bis(cyanomethyl)benzenesulfonamide (PubChem CID 51889727) has the molecular formula C10H6BrCl2N3O2S and a molecular weight of 383.05 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N,N-bis(cyanomethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N,N-bis(cyanomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 51889727 |
| Molecular Formula | C10H6BrCl2N3O2S |
| Molecular Weight | 383.05 g/mol |
| Exact Mass | 380.87 |
| IUPAC Name | 4-bromo-2,6-dichloro-N,N-bis(cyanomethyl)benzenesulfonamide |
| SMILES | N#CCN(CC#N)S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H6BrCl2N3O2S/c11-7-5-8(12)10(9(13)6-7)19(17,18)16(3-1-14)4-2-15/h5-6H,3-4H2 |
| InChIKey | WZNBSCOKAYIWQD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.05 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|