C12H10ClN3O4S — CID 82874481
3-[bis(cyanomethyl)sulfamoyl]-5-chloro-2-methylbenzoic acid (PubChem CID 82874481) has the molecular formula C12H10ClN3O4S and a molecular weight of 327.75 g/mol. Its IUPAC name is 3-[bis(cyanomethyl)sulfamoyl]-5-chloro-2-methylbenzoic acid.
| Compound Name | 3-[bis(cyanomethyl)sulfamoyl]-5-chloro-2-methylbenzoic acid |
|---|---|
| PubChem CID | 82874481 |
| Molecular Formula | C12H10ClN3O4S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-[bis(cyanomethyl)sulfamoyl]-5-chloro-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C12H10ClN3O4S/c1-8-10(12(17)18)6-9(13)7-11(8)21(19,20)16(4-2-14)5-3-15/h6-7H,4-5H2,1H3,(H,17,18) |
| InChIKey | NPHIEHCWTNWOLJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|