C11H12BrCl2NO3S — CID 115754612
4-bromo-2,6-dichloro-N-(2-hydroxyethyl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 115754612) has the molecular formula C11H12BrCl2NO3S and a molecular weight of 389.10 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2-hydroxyethyl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(2-hydroxyethyl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 115754612 |
| Molecular Formula | C11H12BrCl2NO3S |
| Molecular Weight | 389.10 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2-hydroxyethyl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(CCO)S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H12BrCl2NO3S/c1-2-3-15(4-5-16)19(17,18)11-9(13)6-8(12)7-10(11)14/h2,6-7,16H,1,3-5H2 |
| InChIKey | UYHARAAMKXVZAO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|