C9H7BrClF3O — CID 112575189
3-(2-bromo-4-fluorophenyl)-1-chloro-1,1-difluoropropan-2-ol (PubChem CID 112575189) has the molecular formula C9H7BrClF3O and a molecular weight of 303.50 g/mol. Its IUPAC name is 3-(2-bromo-4-fluorophenyl)-1-chloro-1,1-difluoropropan-2-ol.
| Compound Name | 3-(2-bromo-4-fluorophenyl)-1-chloro-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 112575189 |
| Molecular Formula | C9H7BrClF3O |
| Molecular Weight | 303.50 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | 3-(2-bromo-4-fluorophenyl)-1-chloro-1,1-difluoropropan-2-ol |
| SMILES | OC(Cc1ccc(F)cc1Br)C(F)(F)Cl |
| InChI | InChI=1S/C9H7BrClF3O/c10-7-4-6(12)2-1-5(7)3-8(15)9(11,13)14/h1-2,4,8,15H,3H2 |
| InChIKey | GXYPACPWGBKIMR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|