C15H12BrF3O — CID 115786894
1-(2-bromo-4-fluorophenyl)-3-(2,6-difluorophenyl)propan-2-ol (PubChem CID 115786894) has the molecular formula C15H12BrF3O and a molecular weight of 345.16 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3-(2,6-difluorophenyl)propan-2-ol.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3-(2,6-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 115786894 |
| Molecular Formula | C15H12BrF3O |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3-(2,6-difluorophenyl)propan-2-ol |
| SMILES | OC(Cc1ccc(F)cc1Br)Cc1c(F)cccc1F |
| InChI | InChI=1S/C15H12BrF3O/c16-13-7-10(17)5-4-9(13)6-11(20)8-12-14(18)2-1-3-15(12)19/h1-5,7,11,20H,6,8H2 |
| InChIKey | GOFUGIYTONQBOX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |