C15H26ClNO — CID 114201829
1-(5-chlorofuran-2-yl)-3,5-dimethyl-N-propylhexan-1-amine (PubChem CID 114201829) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)-3,5-dimethyl-N-propylhexan-1-amine.
| Compound Name | 1-(5-chlorofuran-2-yl)-3,5-dimethyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 114201829 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)-3,5-dimethyl-N-propylhexan-1-amine |
| SMILES | CCCNC(CC(C)CC(C)C)c1ccc(Cl)o1 |
| InChI | InChI=1S/C15H26ClNO/c1-5-8-17-13(10-12(4)9-11(2)3)14-6-7-15(16)18-14/h6-7,11-13,17H,5,8-10H2,1-4H3 |
| InChIKey | YHLUUZIDGZFPLL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |