C12H14N2O3 — CID 81171172
2-[1-(1,2-oxazol-3-ylmethylamino)ethyl]benzene-1,4-diol (PubChem CID 81171172) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[1-(1,2-oxazol-3-ylmethylamino)ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-(1,2-oxazol-3-ylmethylamino)ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 81171172 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[1-(1,2-oxazol-3-ylmethylamino)ethyl]benzene-1,4-diol |
| SMILES | CC(NCc1ccon1)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H14N2O3/c1-8(13-7-9-4-5-17-14-9)11-6-10(15)2-3-12(11)16/h2-6,8,13,15-16H,7H2,1H3 |
| InChIKey | KTAIJYKLNURXNS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|