C12H14N2O2 — CID 81170422
3-[1-(1,2-oxazol-3-ylmethylamino)ethyl]phenol (PubChem CID 81170422) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-[1-(1,2-oxazol-3-ylmethylamino)ethyl]phenol.
| Compound Name | 3-[1-(1,2-oxazol-3-ylmethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 81170422 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-[1-(1,2-oxazol-3-ylmethylamino)ethyl]phenol |
| SMILES | CC(NCc1ccon1)c1cccc(O)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-9(10-3-2-4-12(15)7-10)13-8-11-5-6-16-14-11/h2-7,9,13,15H,8H2,1H3 |
| InChIKey | JOKXFHRJZLUZOQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |