C19H23NO5S — CID 75477721
ethyl (2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methyl-2-thiophen-2-ylpropanoyl)amino]propanoate (PubChem CID 75477721) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is ethyl (2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methyl-2-thiophen-2-ylpropanoyl)amino]propanoate.
| Compound Name | ethyl (2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methyl-2-thiophen-2-ylpropanoyl)amino]propanoate |
|---|---|
| PubChem CID | 75477721 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | ethyl (2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methyl-2-thiophen-2-ylpropanoyl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)C(C)(C)c1cccs1 |
| InChI | InChI=1S/C19H23NO5S/c1-4-25-17(23)13(10-12-7-8-14(21)15(22)11-12)20-18(24)19(2,3)16-6-5-9-26-16/h5-9,11,13,21-22H,4,10H2,1-3H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | QQCWHOPPRWJBSS-ZDUSSCGKSA-N |
| XLogP | 2.73 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|