C23H29NO6 — CID 100687131
ethyl (2S)-2-[[2-(2-tert-butylphenoxy)acetyl]amino]-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 100687131) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(2-tert-butylphenoxy)acetyl]amino]-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | ethyl (2S)-2-[[2-(2-tert-butylphenoxy)acetyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 100687131 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | ethyl (2S)-2-[[2-(2-tert-butylphenoxy)acetyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C23H29NO6/c1-5-29-22(28)17(12-15-10-11-18(25)19(26)13-15)24-21(27)14-30-20-9-7-6-8-16(20)23(2,3)4/h6-11,13,17,25-26H,5,12,14H2,1-4H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | KQHXVYFUGLIODO-KRWDZBQOSA-N |
| XLogP | 3.06 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|